C10H19NO — CID 177422774
(4aR,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydropyrano[2,3-b]pyridine (PubChem CID 177422774) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (4aR,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydropyrano[2,3-b]pyridine.
| Compound Name | (4aR,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydropyrano[2,3-b]pyridine |
|---|---|
| PubChem CID | 177422774 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (4aR,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydropyrano[2,3-b]pyridine |
| SMILES | CC[C@]12CCCN[C@H]1OCCC2 |
| InChI | InChI=1S/C10H19NO/c1-2-10-5-3-7-11-9(10)12-8-4-6-10/h9,11H,2-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | GDJPEISVBBGXEB-VHSXEESVSA-N |
| XLogP | 1.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |