C12H23NO — CID 25268241
[(4aS,8R,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydro-1H-quinolin-8-yl]methanol (PubChem CID 25268241) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is [(4aS,8R,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydro-1H-quinolin-8-yl]methanol.
| Compound Name | [(4aS,8R,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydro-1H-quinolin-8-yl]methanol |
|---|---|
| PubChem CID | 25268241 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | [(4aS,8R,8aS)-4a-ethyl-2,3,4,5,6,7,8,8a-octahydro-1H-quinolin-8-yl]methanol |
| SMILES | CC[C@]12CCCN[C@H]1[C@H](CO)CCC2 |
| InChI | InChI=1S/C12H23NO/c1-2-12-6-3-5-10(9-14)11(12)13-8-4-7-12/h10-11,13-14H,2-9H2,1H3/t10-,11-,12-/m0/s1 |
| InChIKey | ROYPXVQYWSMENP-SRVKXCTJSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |