C9H16O3 — CID 130875048
(2S,3aR,7aS)-3a-ethyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-ol (PubChem CID 130875048) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2S,3aR,7aS)-3a-ethyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-ol.
| Compound Name | (2S,3aR,7aS)-3a-ethyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-ol |
|---|---|
| PubChem CID | 130875048 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2S,3aR,7aS)-3a-ethyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-ol |
| SMILES | CC[C@]12CCCO[C@H]1O[C@H](O)C2 |
| InChI | InChI=1S/C9H16O3/c1-2-9-4-3-5-11-8(9)12-7(10)6-9/h7-8,10H,2-6H2,1H3/t7-,8-,9+/m0/s1 |
| InChIKey | GMMNPKVSARTKIV-XHNCKOQMSA-N |
| XLogP | 1.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |