C14H20O2 — CID 177423103
(2Z,4E)-2-[(E)-2-methoxyprop-1-enyl]-3,7-dimethylocta-2,4,6-trienal (PubChem CID 177423103) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2Z,4E)-2-[(E)-2-methoxyprop-1-enyl]-3,7-dimethylocta-2,4,6-trienal.
| Compound Name | (2Z,4E)-2-[(E)-2-methoxyprop-1-enyl]-3,7-dimethylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 177423103 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2Z,4E)-2-[(E)-2-methoxyprop-1-enyl]-3,7-dimethylocta-2,4,6-trienal |
| SMILES | CO/C(C)=C/C(C=O)=C(C)/C=C/C=C(C)C |
| InChI | InChI=1S/C14H20O2/c1-11(2)7-6-8-12(3)14(10-15)9-13(4)16-5/h6-10H,1-5H3/b8-6+,13-9+,14-12- |
| InChIKey | RGOSSJKSRLXFJS-KAYABEAHSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|