About CID 177423346
CID 177423346 (PubChem CID 177423346) has the molecular formula C9H13ClO
and a molecular weight of 172.65 g/mol.
Molecular Properties
| Compound Name | CID 177423346 |
| PubChem CID | 177423346 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | — |
| SMILES | Cl[C]OC12CCC(CC1)CC2 |
| InChI | InChI=1S/C9H13ClO/c10-7-11-9-4-1-8(2-5-9)3-6-9/h8H,1-6H2 |
| InChIKey | ZRUKCAATXTXBSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 177423346 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177423346?
The IUPAC name of CID 177423346 (CID 177423346) is not available.
What is the SMILES notation for CID 177423346?
The canonical SMILES for CID 177423346 is Cl[C]OC12CCC(CC1)CC2.
What is the InChIKey of CID 177423346?
The InChIKey is ZRUKCAATXTXBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClO/c10-7-11-9-4-1-8(2-5-9)3-6-9/h8H,1-6H2.
What are the key properties of CID 177423346?
CID 177423346 has a molecular weight of 172.65 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177423346 is sourced from PubChem (CID 177423346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).