2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid

C13H15NO5 — CID 177425598

IUPAC2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid
SMILESO=C(O)CC1CCN(C(=O)OCc2ccccc2)O1
InChIInChI=1S/C13H15NO5/c15-12(16)8-11-6-7-14(19-11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)
InChIKeyIBLLDRNMAHMNIB-UHFFFAOYSA-N
MW265.26 g/mol
LogP1.80
Rot. Bonds4

About 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid

2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid (PubChem CID 177425598) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid
PubChem CID177425598
Molecular FormulaC13H15NO5
Molecular Weight265.26 g/mol
Exact Mass265.10
IUPAC Name2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid
SMILESO=C(O)CC1CCN(C(=O)OCc2ccccc2)O1
InChIInChI=1S/C13H15NO5/c15-12(16)8-11-6-7-14(19-11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)
InChIKeyIBLLDRNMAHMNIB-UHFFFAOYSA-N
XLogP1.80
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.26
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid?
The IUPAC name of 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid (CID 177425598) is 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid.
What is the SMILES notation for 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid?
The canonical SMILES for 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid is O=C(O)CC1CCN(C(=O)OCc2ccccc2)O1.
What is the InChIKey of 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid?
The InChIKey is IBLLDRNMAHMNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c15-12(16)8-11-6-7-14(19-11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16).
What are the key properties of 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid?
2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid has a molecular weight of 265.26 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylmethoxycarbonyl-1,2-oxazolidin-5-yl)acetic acid is sourced from PubChem (CID 177425598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).