C15H10O — CID 177425634
1-cyclopenta-1,2,4-trien-1-yl-3-(4-methylphenyl)prop-2-yn-1-one (PubChem CID 177425634) has the molecular formula C15H10O and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-cyclopenta-1,2,4-trien-1-yl-3-(4-methylphenyl)prop-2-yn-1-one.
| Compound Name | 1-cyclopenta-1,2,4-trien-1-yl-3-(4-methylphenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 177425634 |
| Molecular Formula | C15H10O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-cyclopenta-1,2,4-trien-1-yl-3-(4-methylphenyl)prop-2-yn-1-one |
| SMILES | Cc1ccc(C#CC(=O)C2=C=CC=C2)cc1 |
| InChI | InChI=1S/C15H10O/c1-12-6-8-13(9-7-12)10-11-15(16)14-4-2-3-5-14/h2-4,6-9H,1H3 |
| InChIKey | BXPZVDBEYDMGDS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|