C48H84N8O8 — CID 177426627
CID 177426627 (PubChem CID 177426627) has the molecular formula C48H84N8O8 and a molecular weight of 901.25 g/mol.
| Compound Name | CID 177426627 |
|---|---|
| PubChem CID | 177426627 |
| Molecular Formula | C48H84N8O8 |
| Molecular Weight | 901.25 g/mol |
| Exact Mass | 900.64 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(C(=O)N2CCN(C(=O)C3CC(C)(C)N([O])C(C)(C)C3)CCN(C(=O)C3CC(C)(C)N([O])C(C)(C)C3)CCN(C(=O)C3CC(C)(C)N([O])C(C)(C)C3)CC2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C48H84N8O8/c1-41(2)25-33(26-42(3,4)53(41)61)37(57)49-17-19-50(38(58)34-27-43(5,6)54(62)44(7,8)28-34)21-23-52(40(60)36-31-47(13,14)56(64)48(15,16)32-36)24-22-51(20-18-49)39(59)35-29-45(9,10)55(63)46(11,12)30-35/h33-36H,17-32H2,1-16H3 |
| InChIKey | YGTAWUFHKAMHIP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 173.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |