C18H18O5S — CID 177429936
(1R,2R,5S,6R,8S,9R)-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione (PubChem CID 177429936) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is (1R,2R,5S,6R,8S,9R)-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione.
| Compound Name | (1R,2R,5S,6R,8S,9R)-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
|---|---|
| PubChem CID | 177429936 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (1R,2R,5S,6R,8S,9R)-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
| SMILES | Cc1ccc(S(=O)C[C@]23O[C@H]4[C@@H]5OC(=O)[C@H]4[C@H]2CC(=O)C[C@H]53)cc1 |
| InChI | InChI=1S/C18H18O5S/c1-9-2-4-11(5-3-9)24(21)8-18-12-6-10(19)7-13(18)15-16(23-18)14(12)17(20)22-15/h2-5,12-16H,6-8H2,1H3/t12-,13-,14+,15-,16-,18+,24?/m1/s1 |
| InChIKey | OIDAXNYBYTXYBG-QSOCEKGPSA-N |
| XLogP | 1.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |