C19H20O5S — CID 177496925
(1R,2R,5S,6R,8S,9R)-9-methyl-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione (PubChem CID 177496925) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is (1R,2R,5S,6R,8S,9R)-9-methyl-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione.
| Compound Name | (1R,2R,5S,6R,8S,9R)-9-methyl-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
|---|---|
| PubChem CID | 177496925 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (1R,2R,5S,6R,8S,9R)-9-methyl-8-[(4-methylphenyl)sulfinylmethyl]-3,7-dioxatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
| SMILES | Cc1ccc(S(=O)C[C@@]23O[C@H]4[C@@H]5OC(=O)[C@H]4[C@@]2(C)CC(=O)C[C@H]53)cc1 |
| InChI | InChI=1S/C19H20O5S/c1-10-3-5-12(6-4-10)25(22)9-19-13-7-11(20)8-18(19,2)14-16(24-19)15(13)23-17(14)21/h3-6,13-16H,7-9H2,1-2H3/t13-,14+,15-,16-,18-,19+,25?/m1/s1 |
| InChIKey | NEPWZLKLCNSULO-WMAMNBKDSA-N |
| XLogP | 1.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |