C17H20O6S — CID 10760451
[(1R,2R,6R,7S)-6-methyl-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10760451) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is [(1R,2R,6R,7S)-6-methyl-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,6R,7S)-6-methyl-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10760451 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [(1R,2R,6R,7S)-6-methyl-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]23CC[C@H](O2)[C@]2(C)C(=O)OC[C@H]32)cc1 |
| InChI | InChI=1S/C17H20O6S/c1-11-3-5-12(6-4-11)24(19,20)22-10-17-8-7-14(23-17)16(2)13(17)9-21-15(16)18/h3-6,13-14H,7-10H2,1-2H3/t13-,14-,16+,17-/m0/s1 |
| InChIKey | RPSPGNMABBYMJW-DIECFANBSA-N |
| XLogP | 1.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|