C19H24O5S — CID 10992135
[(3R,3aR,5R,7aR)-7a-methyl-2-oxo-3-prop-2-enyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-5-yl] 4-methylbenzenesulfonate (PubChem CID 10992135) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is [(3R,3aR,5R,7aR)-7a-methyl-2-oxo-3-prop-2-enyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,3aR,5R,7aR)-7a-methyl-2-oxo-3-prop-2-enyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10992135 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [(3R,3aR,5R,7aR)-7a-methyl-2-oxo-3-prop-2-enyl-3,3a,4,5,6,7-hexahydro-1-benzofuran-5-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC[C@H]1C(=O)O[C@]2(C)CC[C@@H](OS(=O)(=O)c3ccc(C)cc3)C[C@H]12 |
| InChI | InChI=1S/C19H24O5S/c1-4-5-16-17-12-14(10-11-19(17,3)23-18(16)20)24-25(21,22)15-8-6-13(2)7-9-15/h4,6-9,14,16-17H,1,5,10-12H2,2-3H3/t14-,16-,17-,19-/m1/s1 |
| InChIKey | JILDLHOXQYYKPH-KLICCBINSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|