C19H28O5S — CID 162411529
cis-tert-butyl (1R,2S)-2-methyl-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 162411529) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is cis-tert-butyl (1R,2S)-2-methyl-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,2S)-2-methyl-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 162411529 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | cis-tert-butyl (1R,2S)-2-methyl-4-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC[C@@H](C(=O)OC(C)(C)C)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C19H28O5S/c1-13-6-9-16(10-7-13)25(21,22)24-15-8-11-17(14(2)12-15)18(20)23-19(3,4)5/h6-7,9-10,14-15,17H,8,11-12H2,1-5H3/t14-,15?,17+/m0/s1 |
| InChIKey | CMLRVPFMLGOUNZ-XJIUDMAQSA-N |
| XLogP | 3.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|