C24H34O8S — CID 11005372
[(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxo-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate (PubChem CID 11005372) has the molecular formula C24H34O8S and a molecular weight of 482.60 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxo-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxo-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11005372 |
| Molecular Formula | C24H34O8S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxo-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate |
| SMILES | COCO[C@@]12CC[C@@](C)(C(=O)C1)[C@H]([C@H]1COC(C)(C)O1)[C@H]2COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34O8S/c1-16-6-8-17(9-7-16)33(26,27)31-13-18-21(19-14-29-22(2,3)32-19)23(4)10-11-24(18,12-20(23)25)30-15-28-5/h6-9,18-19,21H,10-15H2,1-5H3/t18-,19-,21+,23+,24+/m1/s1 |
| InChIKey | FQGBOXVJPMUALD-ZPKWPDFVSA-N |
| XLogP | 3.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|