C16H18O6S — CID 10688388
[(1S,2R,6R,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10688388) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is [(1S,2R,6R,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,6R,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10688388 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(1S,2R,6R,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]23CC[C@@H](O2)[C@H]2COC(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C16H18O6S/c1-10-2-4-11(5-3-10)23(18,19)21-9-16-7-6-13(22-16)12-8-20-15(17)14(12)16/h2-5,12-14H,6-9H2,1H3/t12-,13-,14+,16-/m1/s1 |
| InChIKey | ABCUEUOMGITHIL-HGTKMLMNSA-N |
| XLogP | 1.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|