C17H18O5S — CID 10936543
[(1R,2S,3S,6R,7S)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10936543) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is [(1R,2S,3S,6R,7S)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,3S,6R,7S)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10936543 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(1R,2S,3S,6R,7S)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)[C@H]3[C@@H]2[C@H]2C=C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H18O5S/c1-10-2-6-13(7-3-10)23(19,20)21-9-14-15-11-4-5-12(8-11)16(15)17(18)22-14/h2-7,11-12,14-16H,8-9H2,1H3/t11-,12+,14+,15+,16+/m0/s1 |
| InChIKey | BOFNMARLXXFFBK-OVJXPFRRSA-N |
| XLogP | 2.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|