C18H24O7S — CID 141041621
methyl (1S,3R,4R,5S)-3-acetyloxy-1-(benzenesulfonyloxy)-4,5-dimethylcyclohexane-1-carboxylate (PubChem CID 141041621) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is methyl (1S,3R,4R,5S)-3-acetyloxy-1-(benzenesulfonyloxy)-4,5-dimethylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5S)-3-acetyloxy-1-(benzenesulfonyloxy)-4,5-dimethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141041621 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl (1S,3R,4R,5S)-3-acetyloxy-1-(benzenesulfonyloxy)-4,5-dimethylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(OS(=O)(=O)c2ccccc2)C[C@H](C)[C@@H](C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C18H24O7S/c1-12-10-18(17(20)23-4,11-16(13(12)2)24-14(3)19)25-26(21,22)15-8-6-5-7-9-15/h5-9,12-13,16H,10-11H2,1-4H3/t12-,13+,16+,18-/m0/s1 |
| InChIKey | SSSUJJIXUYKAOI-XGIHMFCUSA-N |
| XLogP | 2.30 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|