C23H36ClNO2Si — CID 177430248
(3R,5E,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-(2-chloroethyl)-3,4,7,8-tetrahydro-2H-azonin-9-one (PubChem CID 177430248) has the molecular formula C23H36ClNO2Si and a molecular weight of 422.09 g/mol. Its IUPAC name is (3R,5E,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-(2-chloroethyl)-3,4,7,8-tetrahydro-2H-azonin-9-one.
| Compound Name | (3R,5E,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-(2-chloroethyl)-3,4,7,8-tetrahydro-2H-azonin-9-one |
|---|---|
| PubChem CID | 177430248 |
| Molecular Formula | C23H36ClNO2Si |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (3R,5E,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-(2-chloroethyl)-3,4,7,8-tetrahydro-2H-azonin-9-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C/C=C/C[C@H](CCCl)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H36ClNO2Si/c1-23(2,3)28(4,5)27-21-14-10-9-13-20(15-16-24)22(26)25(18-21)17-19-11-7-6-8-12-19/h6-12,20-21H,13-18H2,1-5H3/b10-9+/t20-,21-/m1/s1 |
| InChIKey | VFCYBCROFLVRFF-XMHHWPDXSA-N |
| XLogP | 6.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|