C14H9Br2N3O — CID 177430751
(NE)-N-[(4,6-dibromo-1H-benzimidazol-2-yl)-phenylmethylidene]hydroxylamine (PubChem CID 177430751) has the molecular formula C14H9Br2N3O and a molecular weight of 395.05 g/mol. Its IUPAC name is (NE)-N-[(4,6-dibromo-1H-benzimidazol-2-yl)-phenylmethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4,6-dibromo-1H-benzimidazol-2-yl)-phenylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 177430751 |
| Molecular Formula | C14H9Br2N3O |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | (NE)-N-[(4,6-dibromo-1H-benzimidazol-2-yl)-phenylmethylidene]hydroxylamine |
| SMILES | O/N=C(\c1ccccc1)c1nc2c(Br)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C14H9Br2N3O/c15-9-6-10(16)13-11(7-9)17-14(18-13)12(19-20)8-4-2-1-3-5-8/h1-7,20H,(H,17,18)/b19-12+ |
| InChIKey | DWKAFDXIMYLCEG-XDHOZWIPSA-N |
| XLogP | 4.31 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|