About CID 177430776
CID 177430776 (PubChem CID 177430776) has the molecular formula C21H21NO3+
and a molecular weight of 335.40 g/mol.
Molecular Properties
| Compound Name | CID 177430776 |
| PubChem CID | 177430776 |
| Molecular Formula | C21H21NO3+ |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | — |
| SMILES | COc1ccc([N+](c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-23-19-10-4-16(5-11-19)22(17-6-12-20(24-2)13-7-17)18-8-14-21(25-3)15-9-18/h4-15H,1-3H3/q+1 |
| InChIKey | SBHYCVQJVKEERC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 33.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177430776 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177430776?
The IUPAC name of CID 177430776 (CID 177430776) is not available.
What is the SMILES notation for CID 177430776?
The canonical SMILES for CID 177430776 is COc1ccc([N+](c2ccc(OC)cc2)c2ccc(OC)cc2)cc1.
What is the InChIKey of CID 177430776?
The InChIKey is SBHYCVQJVKEERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3/c1-23-19-10-4-16(5-11-19)22(17-6-12-20(24-2)13-7-17)18-8-14-21(25-3)15-9-18/h4-15H,1-3H3/q+1.
What are the key properties of CID 177430776?
CID 177430776 has a molecular weight of 335.40 g/mol, XLogP of 5.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177430776 is sourced from PubChem (CID 177430776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).