C14H16N2OS4 — CID 177431409
(3E)-3-[(E)-[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]methylidenehydrazinylidene]butan-2-one (PubChem CID 177431409) has the molecular formula C14H16N2OS4 and a molecular weight of 356.56 g/mol. Its IUPAC name is (3E)-3-[(E)-[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]methylidenehydrazinylidene]butan-2-one.
| Compound Name | (3E)-3-[(E)-[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]methylidenehydrazinylidene]butan-2-one |
|---|---|
| PubChem CID | 177431409 |
| Molecular Formula | C14H16N2OS4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (3E)-3-[(E)-[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methyl-1,3-dithiol-4-yl]methylidenehydrazinylidene]butan-2-one |
| SMILES | CC(=O)/C(C)=N/N=C/C1=C(C)SC(=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C14H16N2OS4/c1-7(8(2)17)16-15-6-12-11(5)20-14(21-12)13-18-9(3)10(4)19-13/h6H,1-5H3/b15-6+,16-7+ |
| InChIKey | GOQDAMQTDYXVQB-MBGCCUORSA-N |
| XLogP | 5.59 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|