C30H38N6O4P2 — CID 177432556
N-[anilino-[2-[2-[2-(dianilinophosphorylamino)ethoxy]ethoxy]ethylamino]phosphoryl]aniline (PubChem CID 177432556) has the molecular formula C30H38N6O4P2 and a molecular weight of 608.62 g/mol. Its IUPAC name is N-[anilino-[2-[2-[2-(dianilinophosphorylamino)ethoxy]ethoxy]ethylamino]phosphoryl]aniline.
| Compound Name | N-[anilino-[2-[2-[2-(dianilinophosphorylamino)ethoxy]ethoxy]ethylamino]phosphoryl]aniline |
|---|---|
| PubChem CID | 177432556 |
| Molecular Formula | C30H38N6O4P2 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | N-[anilino-[2-[2-[2-(dianilinophosphorylamino)ethoxy]ethoxy]ethylamino]phosphoryl]aniline |
| SMILES | O=P(NCCOCCOCCNP(=O)(Nc1ccccc1)Nc1ccccc1)(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C30H38N6O4P2/c37-41(33-27-13-5-1-6-14-27,34-28-15-7-2-8-16-28)31-21-23-39-25-26-40-24-22-32-42(38,35-29-17-9-3-10-18-29)36-30-19-11-4-12-20-30/h1-20H,21-26H2,(H3,31,33,34,37)(H3,32,35,36,38) |
| InChIKey | NFFIPUPNIQRKCA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|