About 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine
2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine (PubChem CID 177432877) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine.
Analyze 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine?
The IUPAC name of 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine (CID 177432877) is 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine.
What is the SMILES notation for 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine?
The canonical SMILES for 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine is CN(C)CCC1=C=CC=C1.
What is the InChIKey of 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine?
The InChIKey is JKEVJWRPVSABLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-10(2)8-7-9-5-3-4-6-9/h3-5H,7-8H2,1-2H3.
What are the key properties of 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine?
2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine has a molecular weight of 135.21 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,2,4-trien-1-yl-N,N-dimethylethanamine is sourced from PubChem (CID 177432877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).