C12H20FN — CID 146499610
(Z,4E)-4-(fluoromethylidene)-N,N-dimethyl-2-prop-1-en-2-ylhex-2-en-1-amine (PubChem CID 146499610) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (Z,4E)-4-(fluoromethylidene)-N,N-dimethyl-2-prop-1-en-2-ylhex-2-en-1-amine.
| Compound Name | (Z,4E)-4-(fluoromethylidene)-N,N-dimethyl-2-prop-1-en-2-ylhex-2-en-1-amine |
|---|---|
| PubChem CID | 146499610 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (Z,4E)-4-(fluoromethylidene)-N,N-dimethyl-2-prop-1-en-2-ylhex-2-en-1-amine |
| SMILES | C=C(C)/C(=C/C(=C/F)CC)CN(C)C |
| InChI | InChI=1S/C12H20FN/c1-6-11(8-13)7-12(10(2)3)9-14(4)5/h7-8H,2,6,9H2,1,3-5H3/b11-8+,12-7+ |
| InChIKey | SDIPTALQSBLJJJ-NFLJZBCPSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|