About 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole
1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole (PubChem CID 90804972) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole |
| PubChem CID | 90804972 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole |
| SMILES | C=C(C)C1=C(C(=C)F)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H20FN/c1-9(2)11-7-15(13(4,5)6)8-12(11)10(3)14/h1,3,7-8H2,2,4-6H3 |
| InChIKey | GSFBSMIHKDQYIW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole?
The IUPAC name of 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole (CID 90804972) is 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole.
What is the SMILES notation for 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole?
The canonical SMILES for 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole is C=C(C)C1=C(C(=C)F)CN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole?
The InChIKey is GSFBSMIHKDQYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FN/c1-9(2)11-7-15(13(4,5)6)8-12(11)10(3)14/h1,3,7-8H2,2,4-6H3.
What are the key properties of 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole?
1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole has a molecular weight of 209.31 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(1-fluoroethenyl)-4-prop-1-en-2-yl-2,5-dihydropyrrole is sourced from PubChem (CID 90804972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).