C14H24FN — CID 146586092
(3E,5Z)-7-(fluoromethyl)-N,3-dimethyl-N-propylocta-3,5,7-trien-2-amine (PubChem CID 146586092) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is (3E,5Z)-7-(fluoromethyl)-N,3-dimethyl-N-propylocta-3,5,7-trien-2-amine.
| Compound Name | (3E,5Z)-7-(fluoromethyl)-N,3-dimethyl-N-propylocta-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 146586092 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (3E,5Z)-7-(fluoromethyl)-N,3-dimethyl-N-propylocta-3,5,7-trien-2-amine |
| SMILES | C=C(/C=C\C=C(/C)C(C)N(C)CCC)CF |
| InChI | InChI=1S/C14H24FN/c1-6-10-16(5)14(4)13(3)9-7-8-12(2)11-15/h7-9,14H,2,6,10-11H2,1,3-5H3/b8-7-,13-9+ |
| InChIKey | BGIMEHMOVXNVGQ-XTYDYKDCSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|