C27H41N7O6 — CID 177433770
21,24-dioxa-1,4,8,11,15,18,34-heptazatetracyclo[16.8.7.28,11.128,32]hexatriaconta-28(34),29,31-triene-3,16,27,33-tetrone (PubChem CID 177433770) has the molecular formula C27H41N7O6 and a molecular weight of 559.67 g/mol. Its IUPAC name is 21,24-dioxa-1,4,8,11,15,18,34-heptazatetracyclo[16.8.7.28,11.128,32]hexatriaconta-28(34),29,31-triene-3,16,27,33-tetrone.
| Compound Name | 21,24-dioxa-1,4,8,11,15,18,34-heptazatetracyclo[16.8.7.28,11.128,32]hexatriaconta-28(34),29,31-triene-3,16,27,33-tetrone |
|---|---|
| PubChem CID | 177433770 |
| Molecular Formula | C27H41N7O6 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 21,24-dioxa-1,4,8,11,15,18,34-heptazatetracyclo[16.8.7.28,11.128,32]hexatriaconta-28(34),29,31-triene-3,16,27,33-tetrone |
| SMILES | O=C1CN2CCOCCOCCN(CC(=O)NCCCN3CCN(CCCN1)CC3)C(=O)c1cccc(n1)C2=O |
| InChI | InChI=1S/C27H41N7O6/c35-24-20-33-14-16-39-18-19-40-17-15-34(27(38)23-5-1-4-22(30-23)26(33)37)21-25(36)29-7-3-9-32-12-10-31(11-13-32)8-2-6-28-24/h1,4-5H,2-3,6-21H2,(H,28,35)(H,29,36) |
| InChIKey | MALQGKIQPHFCMJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |