C18H24O4 — CID 177434994
ethyl 5-[(6R)-5-methyl-6-phenyl-3,6-dihydro-1,2-dioxin-3-yl]pentanoate (PubChem CID 177434994) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl 5-[(6R)-5-methyl-6-phenyl-3,6-dihydro-1,2-dioxin-3-yl]pentanoate.
| Compound Name | ethyl 5-[(6R)-5-methyl-6-phenyl-3,6-dihydro-1,2-dioxin-3-yl]pentanoate |
|---|---|
| PubChem CID | 177434994 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | ethyl 5-[(6R)-5-methyl-6-phenyl-3,6-dihydro-1,2-dioxin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCC1C=C(C)[C@H](c2ccccc2)OO1 |
| InChI | InChI=1S/C18H24O4/c1-3-20-17(19)12-8-7-11-16-13-14(2)18(22-21-16)15-9-5-4-6-10-15/h4-6,9-10,13,16,18H,3,7-8,11-12H2,1-2H3/t16?,18-/m1/s1 |
| InChIKey | VTUIZPZTMGSGEA-UHUGOGIASA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|