C7H7NO5 — CID 177436620
2-(1-azaniumyl-2-carboxyethyl)-3,4-dioxocyclobuten-1-olate (PubChem CID 177436620) has the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. Its IUPAC name is 2-(1-azaniumyl-2-carboxyethyl)-3,4-dioxocyclobuten-1-olate.
| Compound Name | 2-(1-azaniumyl-2-carboxyethyl)-3,4-dioxocyclobuten-1-olate |
|---|---|
| PubChem CID | 177436620 |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2-(1-azaniumyl-2-carboxyethyl)-3,4-dioxocyclobuten-1-olate |
| SMILES | [NH3+]C(CC(=O)O)c1c([O-])c(=O)c1=O |
| InChI | InChI=1S/C7H7NO5/c8-2(1-3(9)10)4-5(11)7(13)6(4)12/h2,11H,1,8H2,(H,9,10) |
| InChIKey | ANJNMQGSKUFUFN-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|