About 2-iodobutanedioic acid
2-iodobutanedioic acid (PubChem CID 21453258) has the molecular formula C4H5IO4
and a molecular weight of 243.98 g/mol. Its IUPAC name is 2-iodobutanedioic acid.
Molecular Properties
| Compound Name | 2-iodobutanedioic acid |
| PubChem CID | 21453258 |
| Molecular Formula | C4H5IO4 |
| Molecular Weight | 243.98 g/mol |
| Exact Mass | 243.92 |
| IUPAC Name | 2-iodobutanedioic acid |
| SMILES | O=C(O)CC(I)C(=O)O |
| InChI | InChI=1S/C4H5IO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) |
| InChIKey | TVXYDMHGNLZNAI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.98 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobutanedioic acid?
The IUPAC name of 2-iodobutanedioic acid (CID 21453258) is 2-iodobutanedioic acid.
What is the SMILES notation for 2-iodobutanedioic acid?
The canonical SMILES for 2-iodobutanedioic acid is O=C(O)CC(I)C(=O)O.
What is the InChIKey of 2-iodobutanedioic acid?
The InChIKey is TVXYDMHGNLZNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5IO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-iodobutanedioic acid?
2-iodobutanedioic acid has a molecular weight of 243.98 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobutanedioic acid is sourced from PubChem (CID 21453258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).