About 2-phosphanylbutanedioic acid
2-phosphanylbutanedioic acid (PubChem CID 19911180) has the molecular formula C4H7O4P
and a molecular weight of 150.07 g/mol. Its IUPAC name is 2-phosphanylbutanedioic acid.
Molecular Properties
| Compound Name | 2-phosphanylbutanedioic acid |
| PubChem CID | 19911180 |
| Molecular Formula | C4H7O4P |
| Molecular Weight | 150.07 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 2-phosphanylbutanedioic acid |
| SMILES | O=C(O)CC(P)C(=O)O |
| InChI | InChI=1S/C4H7O4P/c5-3(6)1-2(9)4(7)8/h2H,1,9H2,(H,5,6)(H,7,8) |
| InChIKey | UCNUAGQCOCSQMY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.07 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphanylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphanylbutanedioic acid?
The IUPAC name of 2-phosphanylbutanedioic acid (CID 19911180) is 2-phosphanylbutanedioic acid.
What is the SMILES notation for 2-phosphanylbutanedioic acid?
The canonical SMILES for 2-phosphanylbutanedioic acid is O=C(O)CC(P)C(=O)O.
What is the InChIKey of 2-phosphanylbutanedioic acid?
The InChIKey is UCNUAGQCOCSQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O4P/c5-3(6)1-2(9)4(7)8/h2H,1,9H2,(H,5,6)(H,7,8).
What are the key properties of 2-phosphanylbutanedioic acid?
2-phosphanylbutanedioic acid has a molecular weight of 150.07 g/mol, XLogP of -0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphanylbutanedioic acid is sourced from PubChem (CID 19911180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).