About bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate
bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate (PubChem CID 177437442) has the molecular formula C34H21N3O4
and a molecular weight of 535.56 g/mol. Its IUPAC name is bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate |
| PubChem CID | 177437442 |
| Molecular Formula | C34H21N3O4 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate |
| SMILES | N#Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C#N)cc3)c2N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H21N3O4/c35-22-24-14-18-28(19-15-24)40-33(38)30-12-7-13-31(34(39)41-29-20-16-25(23-36)17-21-29)32(30)37(26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-21H |
| InChIKey | IWPBYCLMIACWGG-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate?
The IUPAC name of bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate (CID 177437442) is bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate.
What is the SMILES notation for bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate?
The canonical SMILES for bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate is N#Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C#N)cc3)c2N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate?
The InChIKey is IWPBYCLMIACWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H21N3O4/c35-22-24-14-18-28(19-15-24)40-33(38)30-12-7-13-31(34(39)41-29-20-16-25(23-36)17-21-29)32(30)37(26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-21H.
What are the key properties of bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate?
bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate has a molecular weight of 535.56 g/mol, XLogP of 7.34, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-cyanophenyl) 2-(N-phenylanilino)benzene-1,3-dicarboxylate is sourced from PubChem (CID 177437442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).