C23H25N5O4S — CID 177437908
(2S)-2-[[(Z)-N'-(1,3-benzothiazol-2-yl)-N-(2-phenylacetyl)carbamimidoyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 177437908) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is (2S)-2-[[(Z)-N'-(1,3-benzothiazol-2-yl)-N-(2-phenylacetyl)carbamimidoyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(Z)-N'-(1,3-benzothiazol-2-yl)-N-(2-phenylacetyl)carbamimidoyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 177437908 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (2S)-2-[[(Z)-N'-(1,3-benzothiazol-2-yl)-N-(2-phenylacetyl)carbamimidoyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)N/C(=N\c1nc2ccccc2s1)NC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H25N5O4S/c1-14(2)12-17(20(30)31)24-22(32)27-21(26-19(29)13-15-8-4-3-5-9-15)28-23-25-16-10-6-7-11-18(16)33-23/h3-11,14,17H,12-13H2,1-2H3,(H,30,31)(H3,24,25,26,27,28,29,32)/t17-/m0/s1 |
| InChIKey | YXRJHRLWSXEWGC-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|