C17H30O4Si — CID 177437951
methyl (1R,2R)-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-3-ene-1-carboxylate (PubChem CID 177437951) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is methyl (1R,2R)-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 177437951 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | methyl (1R,2R)-2-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-3-ene-1-carboxylate |
| SMILES | C/C=C(\O[C@@H]1C=CCC[C@H]1C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-8-15(21-22(6,7)17(2,3)4)20-14-12-10-9-11-13(14)16(18)19-5/h8,10,12-14H,9,11H2,1-7H3/b15-8+/t13-,14-/m1/s1 |
| InChIKey | ZVCUHFLIKIWKLU-RNRBBCFGSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|