C21H29N3O3 — CID 177438453
tert-butyl (2S,3aR,8bR)-2-carbamoyl-8b-(2-methylbut-3-en-2-yl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole-4-carboxylate (PubChem CID 177438453) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl (2S,3aR,8bR)-2-carbamoyl-8b-(2-methylbut-3-en-2-yl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole-4-carboxylate.
| Compound Name | tert-butyl (2S,3aR,8bR)-2-carbamoyl-8b-(2-methylbut-3-en-2-yl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 177438453 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl (2S,3aR,8bR)-2-carbamoyl-8b-(2-methylbut-3-en-2-yl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole-4-carboxylate |
| SMILES | C=CC(C)(C)[C@@]12C[C@@H](C(N)=O)N[C@@H]1N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C21H29N3O3/c1-7-20(5,6)21-12-14(16(22)25)23-17(21)24(18(26)27-19(2,3)4)15-11-9-8-10-13(15)21/h7-11,14,17,23H,1,12H2,2-6H3,(H2,22,25)/t14-,17+,21+/m0/s1 |
| InChIKey | MAIYMWSNCLUJPJ-AVBTWRTFSA-N |
| XLogP | 3.07 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|