C36H45N3O8 — CID 101005841
ditert-butyl (2S,3aR,8bR)-2-[[(2R)-1-methoxy-1,3-dioxo-3-phenylpropan-2-yl]carbamoyl]-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-3,4-dicarboxylate (PubChem CID 101005841) has the molecular formula C36H45N3O8 and a molecular weight of 647.77 g/mol. Its IUPAC name is ditert-butyl (2S,3aR,8bR)-2-[[(2R)-1-methoxy-1,3-dioxo-3-phenylpropan-2-yl]carbamoyl]-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-3,4-dicarboxylate.
| Compound Name | ditert-butyl (2S,3aR,8bR)-2-[[(2R)-1-methoxy-1,3-dioxo-3-phenylpropan-2-yl]carbamoyl]-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101005841 |
| Molecular Formula | C36H45N3O8 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | ditert-butyl (2S,3aR,8bR)-2-[[(2R)-1-methoxy-1,3-dioxo-3-phenylpropan-2-yl]carbamoyl]-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-3,4-dicarboxylate |
| SMILES | C=CC(C)(C)[C@@]12C[C@@H](C(=O)N[C@@H](C(=O)OC)C(=O)c3ccccc3)N(C(=O)OC(C)(C)C)[C@@H]1N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C36H45N3O8/c1-11-35(8,9)36-21-25(28(41)37-26(29(42)45-10)27(40)22-17-13-12-14-18-22)39(32(44)47-34(5,6)7)30(36)38(31(43)46-33(2,3)4)24-20-16-15-19-23(24)36/h11-20,25-26,30H,1,21H2,2-10H3,(H,37,41)/t25-,26+,30-,36+/m0/s1 |
| InChIKey | PKWFGQQSKXROCI-ISSSJVEYSA-N |
| XLogP | 5.77 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|