C38H36N2O6Se — CID 138453442
4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 138453442) has the molecular formula C38H36N2O6Se and a molecular weight of 695.67 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 138453442 |
| Molecular Formula | C38H36N2O6Se |
| Molecular Weight | 695.67 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1CC2([Se]c3ccccc3)c3ccccc3N(C(=O)OC(C)(C)C)C2N1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H36N2O6Se/c1-37(2,3)46-36(43)39-31-21-13-12-20-30(31)38(47-24-14-6-5-7-15-24)22-32(33(41)44-4)40(34(38)39)35(42)45-23-29-27-18-10-8-16-25(27)26-17-9-11-19-28(26)29/h5-21,29,32,34H,22-23H2,1-4H3/t32-,34?,38?/m0/s1 |
| InChIKey | GXPFRYDFZXTOEH-ARLVUHNPSA-N |
| XLogP | 6.19 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|