C39H43BrN4O7 — CID 25112310
3-O,4-O-ditert-butyl 2-O-methyl (2R,3aR,8bR)-8b-[3-[2-[(4-bromobenzoyl)amino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 25112310) has the molecular formula C39H43BrN4O7 and a molecular weight of 759.70 g/mol. Its IUPAC name is 3-O,4-O-ditert-butyl 2-O-methyl (2R,3aR,8bR)-8b-[3-[2-[(4-bromobenzoyl)amino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-ditert-butyl 2-O-methyl (2R,3aR,8bR)-8b-[3-[2-[(4-bromobenzoyl)amino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 25112310 |
| Molecular Formula | C39H43BrN4O7 |
| Molecular Weight | 759.70 g/mol |
| Exact Mass | 758.23 |
| IUPAC Name | 3-O,4-O-ditert-butyl 2-O-methyl (2R,3aR,8bR)-8b-[3-[2-[(4-bromobenzoyl)amino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(n3cc(CCNC(=O)c4ccc(Br)cc4)c4ccccc43)c3ccccc3N(C(=O)OC(C)(C)C)[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H43BrN4O7/c1-37(2,3)50-35(47)43-30-15-11-9-13-28(30)39(22-31(33(46)49-7)44(34(39)43)36(48)51-38(4,5)6)42-23-25(27-12-8-10-14-29(27)42)20-21-41-32(45)24-16-18-26(40)19-17-24/h8-19,23,31,34H,20-22H2,1-7H3,(H,41,45)/t31-,34+,39-/m1/s1 |
| InChIKey | FGDQPOZNZZIMBC-KVEZMQAFSA-N |
| XLogP | 7.38 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|