C32H34IN5O6S — CID 46192927
tert-butyl (3aS,8bS)-5-iodo-3-methyl-8b-[3-[2-[(2-nitrophenyl)sulfonylamino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-4-carboxylate (PubChem CID 46192927) has the molecular formula C32H34IN5O6S and a molecular weight of 743.62 g/mol. Its IUPAC name is tert-butyl (3aS,8bS)-5-iodo-3-methyl-8b-[3-[2-[(2-nitrophenyl)sulfonylamino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-4-carboxylate.
| Compound Name | tert-butyl (3aS,8bS)-5-iodo-3-methyl-8b-[3-[2-[(2-nitrophenyl)sulfonylamino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 46192927 |
| Molecular Formula | C32H34IN5O6S |
| Molecular Weight | 743.62 g/mol |
| Exact Mass | 743.13 |
| IUPAC Name | tert-butyl (3aS,8bS)-5-iodo-3-methyl-8b-[3-[2-[(2-nitrophenyl)sulfonylamino]ethyl]indol-1-yl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-4-carboxylate |
| SMILES | CN1CC[C@]2(n3cc(CCNS(=O)(=O)c4ccccc4[N+](=O)[O-])c4ccccc43)c3cccc(I)c3N(C(=O)OC(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C32H34IN5O6S/c1-31(2,3)44-30(39)37-28-23(11-9-12-24(28)33)32(17-19-35(4)29(32)37)36-20-21(22-10-5-6-13-25(22)36)16-18-34-45(42,43)27-15-8-7-14-26(27)38(40)41/h5-15,20,29,34H,16-19H2,1-4H3/t29-,32-/m0/s1 |
| InChIKey | ZPFZTUKXVXPAFL-NYDCQLBNSA-N |
| XLogP | 5.84 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|