C18H20N2O5S — CID 44521145
N-[2-[2-[(E,3S)-3-hydroxybut-1-enyl]phenyl]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 44521145) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[2-[2-[(E,3S)-3-hydroxybut-1-enyl]phenyl]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[2-[(E,3S)-3-hydroxybut-1-enyl]phenyl]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 44521145 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[2-[2-[(E,3S)-3-hydroxybut-1-enyl]phenyl]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | C[C@H](O)/C=C/c1ccccc1CCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O5S/c1-14(21)10-11-15-6-2-3-7-16(15)12-13-19-26(24,25)18-9-5-4-8-17(18)20(22)23/h2-11,14,19,21H,12-13H2,1H3/b11-10+/t14-/m0/s1 |
| InChIKey | JIOLPHRGBKVHTO-VNDWYCCKSA-N |
| XLogP | 2.51 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|