C28H34N2O6Se — CID 11169112
3-O,4-O-ditert-butyl 2-O-methyl (2S,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 11169112) has the molecular formula C28H34N2O6Se and a molecular weight of 573.55 g/mol. Its IUPAC name is 3-O,4-O-ditert-butyl 2-O-methyl (2S,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-ditert-butyl 2-O-methyl (2S,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 11169112 |
| Molecular Formula | C28H34N2O6Se |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 3-O,4-O-ditert-butyl 2-O-methyl (2S,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2([Se]c3ccccc3)c3ccccc3N(C(=O)OC(C)(C)C)C2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34N2O6Se/c1-26(2,3)35-24(32)29-20-16-12-11-15-19(20)28(37-18-13-9-8-10-14-18)17-21(22(31)34-7)30(23(28)29)25(33)36-27(4,5)6/h8-16,21,23H,17H2,1-7H3/t21-,23?,28+/m0/s1 |
| InChIKey | IONSSJILTZYECU-UTMWSDKSSA-N |
| XLogP | 4.18 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|