C16H19N3O9S — CID 54762432
[(2S,3aS,8bS)-2,3,4-tris(methoxycarbonyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]sulfamic acid (PubChem CID 54762432) has the molecular formula C16H19N3O9S and a molecular weight of 429.41 g/mol. Its IUPAC name is [(2S,3aS,8bS)-2,3,4-tris(methoxycarbonyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]sulfamic acid.
| Compound Name | [(2S,3aS,8bS)-2,3,4-tris(methoxycarbonyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]sulfamic acid |
|---|---|
| PubChem CID | 54762432 |
| Molecular Formula | C16H19N3O9S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [(2S,3aS,8bS)-2,3,4-tris(methoxycarbonyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]sulfamic acid |
| SMILES | COC(=O)[C@@H]1C[C@]2(NS(=O)(=O)O)c3ccccc3N(C(=O)OC)[C@@H]2N1C(=O)OC |
| InChI | InChI=1S/C16H19N3O9S/c1-26-12(20)11-8-16(17-29(23,24)25)9-6-4-5-7-10(9)18(14(21)27-2)13(16)19(11)15(22)28-3/h4-7,11,13,17H,8H2,1-3H3,(H,23,24,25)/t11-,13+,16-/m0/s1 |
| InChIKey | TZRKJURYSLLQJC-GHJWDPDVSA-N |
| XLogP | 0.20 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|