C23H24N2O7 — CID 132965749
trimethyl (2S,3aS,8bR)-8b-(2-hydroxy-5-methylphenyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 132965749) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is trimethyl (2S,3aS,8bR)-8b-(2-hydroxy-5-methylphenyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3aS,8bR)-8b-(2-hydroxy-5-methylphenyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 132965749 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | trimethyl (2S,3aS,8bR)-8b-(2-hydroxy-5-methylphenyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(c3cc(C)ccc3O)c3ccccc3N(C(=O)OC)[C@@H]2N1C(=O)OC |
| InChI | InChI=1S/C23H24N2O7/c1-13-9-10-18(26)15(11-13)23-12-17(19(27)30-2)25(22(29)32-4)20(23)24(21(28)31-3)16-8-6-5-7-14(16)23/h5-11,17,20,26H,12H2,1-4H3/t17-,20+,23+/m0/s1 |
| InChIKey | UYKFRWHDGOIHEE-XTQVGHSUSA-N |
| XLogP | 2.91 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|