C22H22N2O6Se — CID 11799225
trimethyl (2S,3aR,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 11799225) has the molecular formula C22H22N2O6Se and a molecular weight of 489.39 g/mol. Its IUPAC name is trimethyl (2S,3aR,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3aR,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 11799225 |
| Molecular Formula | C22H22N2O6Se |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | trimethyl (2S,3aR,8bR)-8b-phenylselanyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2([Se]c3ccccc3)c3ccccc3N(C(=O)OC)[C@H]2N1C(=O)OC |
| InChI | InChI=1S/C22H22N2O6Se/c1-28-18(25)17-13-22(31-14-9-5-4-6-10-14)15-11-7-8-12-16(15)23(20(26)29-2)19(22)24(17)21(27)30-3/h4-12,17,19H,13H2,1-3H3/t17-,19-,22+/m0/s1 |
| InChIKey | BLHRIRVCNWQWAX-LQBOVUBWSA-N |
| XLogP | 1.84 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|