C37H40N2O6 — CID 138453445
4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,3aR,8bR)-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 138453445) has the molecular formula C37H40N2O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,3aR,8bR)-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,3aR,8bR)-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 138453445 |
| Molecular Formula | C37H40N2O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 4-O-tert-butyl 3-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S,3aR,8bR)-8b-(2-methylbut-3-en-2-yl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | C=CC(C)(C)[C@@]12C[C@@H](C(=O)OC)N(C(=O)OCC3c4ccccc4-c4ccccc43)[C@@H]1N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C37H40N2O6/c1-8-36(5,6)37-21-30(31(40)43-7)39(32(37)38(34(42)45-35(2,3)4)29-20-14-13-19-28(29)37)33(41)44-22-27-25-17-11-9-15-23(25)24-16-10-12-18-26(24)27/h8-20,27,30,32H,1,21-22H2,2-7H3/t30-,32-,37+/m0/s1 |
| InChIKey | LMQZYEPTBZGIFV-JGADYYLWSA-N |
| XLogP | 7.41 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|