C21H21NO4 — CID 11131903
dimethyl (2S,3aR,8bS)-7-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1,2-dicarboxylate (PubChem CID 11131903) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is dimethyl (2S,3aR,8bS)-7-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1,2-dicarboxylate.
| Compound Name | dimethyl (2S,3aR,8bS)-7-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11131903 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | dimethyl (2S,3aR,8bS)-7-phenyl-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2Cc3ccc(-c4ccccc4)cc3[C@H]2N1C(=O)OC |
| InChI | InChI=1S/C21H21NO4/c1-25-20(23)18-12-16-10-15-9-8-14(13-6-4-3-5-7-13)11-17(15)19(16)22(18)21(24)26-2/h3-9,11,16,18-19H,10,12H2,1-2H3/t16-,18+,19+/m1/s1 |
| InChIKey | LBVQRXQSABHOBU-NEWSRXKRSA-N |
| XLogP | 3.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |