C12H15N3 — CID 177439354
N,N-bis(prop-2-enyl)-N'-pyridin-2-ylmethanimidamide (PubChem CID 177439354) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-N'-pyridin-2-ylmethanimidamide.
| Compound Name | N,N-bis(prop-2-enyl)-N'-pyridin-2-ylmethanimidamide |
|---|---|
| PubChem CID | 177439354 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N,N-bis(prop-2-enyl)-N'-pyridin-2-ylmethanimidamide |
| SMILES | C=CCN(/C=N/c1ccccn1)CC=C |
| InChI | InChI=1S/C12H15N3/c1-3-9-15(10-4-2)11-14-12-7-5-6-8-13-12/h3-8,11H,1-2,9-10H2/b14-11+ |
| InChIKey | UAIGTHTVWPXOMG-SDNWHVSQSA-N |
| XLogP | 2.42 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|