C29H42O5 — CID 177439517
(3E,5E,7E,9R,11E,13S,14S,15S,17Z,19E,22R)-22-[(E)-but-1-enyl]-14,15-dihydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one (PubChem CID 177439517) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is (3E,5E,7E,9R,11E,13S,14S,15S,17Z,19E,22R)-22-[(E)-but-1-enyl]-14,15-dihydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one.
| Compound Name | (3E,5E,7E,9R,11E,13S,14S,15S,17Z,19E,22R)-22-[(E)-but-1-enyl]-14,15-dihydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 177439517 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (3E,5E,7E,9R,11E,13S,14S,15S,17Z,19E,22R)-22-[(E)-but-1-enyl]-14,15-dihydroxy-16-methoxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
| SMILES | CC/C=C/[C@H]1C/C=C/C=C\C(OC)[C@@H](O)[C@@H](O)[C@@H](C)/C=C/C[C@@H](C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C29H42O5/c1-6-7-17-25-18-9-8-10-19-26(33-5)29(32)28(31)24(4)16-12-15-22(2)13-11-14-23(3)20-21-27(30)34-25/h7-14,16-17,19-22,24-26,28-29,31-32H,6,15,18H2,1-5H3/b9-8+,13-11+,16-12+,17-7+,19-10-,21-20+,23-14+/t22-,24-,25-,26?,28-,29+/m0/s1 |
| InChIKey | YHRYKMQBQALRPC-AZLBQNPMSA-N |
| XLogP | 5.39 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|