C27H42O8Si2 — CID 177440251
triethoxy-(9-methyl-14-triethoxysilyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-5-yl)silane (PubChem CID 177440251) has the molecular formula C27H42O8Si2 and a molecular weight of 550.80 g/mol. Its IUPAC name is triethoxy-(9-methyl-14-triethoxysilyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-5-yl)silane.
| Compound Name | triethoxy-(9-methyl-14-triethoxysilyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-5-yl)silane |
|---|---|
| PubChem CID | 177440251 |
| Molecular Formula | C27H42O8Si2 |
| Molecular Weight | 550.80 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | triethoxy-(9-methyl-14-triethoxysilyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-5-yl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc2c(c1)OCC(C)Oc1cc([Si](OCC)(OCC)OCC)ccc1-2 |
| InChI | InChI=1S/C27H42O8Si2/c1-8-29-36(30-9-2,31-10-3)22-14-16-24-25-17-15-23(37(32-11-4,33-12-5)34-13-6)19-27(25)35-21(7)20-28-26(24)18-22/h14-19,21H,8-13,20H2,1-7H3 |
| InChIKey | ADJPSACZTWVGSB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|