C16H18N8O12 — CID 177441684
(Z)-(2-carboxypyrrolidin-1-yl)-[5-[(Z)-[(2-carboxypyrrolidin-1-yl)-oxidoazaniumylidene]amino]oxy-2,4-dinitrophenoxy]imino-oxidoazanium (PubChem CID 177441684) has the molecular formula C16H18N8O12 and a molecular weight of 514.36 g/mol. Its IUPAC name is (Z)-(2-carboxypyrrolidin-1-yl)-[5-[(Z)-[(2-carboxypyrrolidin-1-yl)-oxidoazaniumylidene]amino]oxy-2,4-dinitrophenoxy]imino-oxidoazanium.
| Compound Name | (Z)-(2-carboxypyrrolidin-1-yl)-[5-[(Z)-[(2-carboxypyrrolidin-1-yl)-oxidoazaniumylidene]amino]oxy-2,4-dinitrophenoxy]imino-oxidoazanium |
|---|---|
| PubChem CID | 177441684 |
| Molecular Formula | C16H18N8O12 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (Z)-(2-carboxypyrrolidin-1-yl)-[5-[(Z)-[(2-carboxypyrrolidin-1-yl)-oxidoazaniumylidene]amino]oxy-2,4-dinitrophenoxy]imino-oxidoazanium |
| SMILES | O=C(O)C1CCCN1/[N+]([O-])=N/Oc1cc(O/N=[N+](\[O-])N2CCCC2C(=O)O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N8O12/c25-15(26)9-3-1-5-19(9)23(33)17-35-13-8-14(12(22(31)32)7-11(13)21(29)30)36-18-24(34)20-6-2-4-10(20)16(27)28/h7-10H,1-6H2,(H,25,26)(H,27,28)/b23-17-,24-18- |
| InChIKey | YIYHHFNVWSZVJN-BOYKQRMESA-N |
| XLogP | 0.94 |
| TPSA | 262.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|